C25H19N5O2S3 — CID 2243013
2-[(12-oxo-11-phenyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]-N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide (PubChem CID 2243013) has the molecular formula C25H19N5O2S3 and a molecular weight of 517.66 g/mol. Its IUPAC name is 2-[(12-oxo-11-phenyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]-N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide.
| Compound Name | 2-[(12-oxo-11-phenyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]-N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 2243013 |
| Molecular Formula | C25H19N5O2S3 |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.07 |
| IUPAC Name | 2-[(12-oxo-11-phenyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)sulfanyl]-N-(3-phenyl-1,2,4-thiadiazol-5-yl)acetamide |
| SMILES | O=C(CSc1nc2sc3c(c2c(=O)n1-c1ccccc1)CCC3)Nc1nc(-c2ccccc2)ns1 |
| InChI | InChI=1S/C25H19N5O2S3/c31-19(26-24-27-21(29-35-24)15-8-3-1-4-9-15)14-33-25-28-22-20(17-12-7-13-18(17)34-22)23(32)30(25)16-10-5-2-6-11-16/h1-6,8-11H,7,12-14H2,(H,26,27,29,31) |
| InChIKey | KQUODLOFRXFJIR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |