C18H31NO — CID 11277414
(5R,8aR)-5-[(E)-dec-2-enyl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 11277414) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is (5R,8aR)-5-[(E)-dec-2-enyl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (5R,8aR)-5-[(E)-dec-2-enyl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 11277414 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | (5R,8aR)-5-[(E)-dec-2-enyl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | CCCCCCC/C=C/C[C@H]1CCC[C@@H]2CCC(=O)N21 |
| InChI | InChI=1S/C18H31NO/c1-2-3-4-5-6-7-8-9-11-16-12-10-13-17-14-15-18(20)19(16)17/h8-9,16-17H,2-7,10-15H2,1H3/b9-8+/t16-,17+/m0/s1 |
| InChIKey | JVZMILOBSOPNSB-IBHATUTGSA-N |
| XLogP | 4.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|