About (E)-non-2-ene;2-[(E)-oct-2-enyl]cyclopentan-1-one
(E)-non-2-ene;2-[(E)-oct-2-enyl]cyclopentan-1-one (PubChem CID 174922472) has the molecular formula C22H40O
and a molecular weight of 320.56 g/mol. Its IUPAC name is (E)-non-2-ene;2-[(E)-oct-2-enyl]cyclopentan-1-one.
Molecular Properties
| Compound Name | (E)-non-2-ene;2-[(E)-oct-2-enyl]cyclopentan-1-one |
| PubChem CID | 174922472 |
| Molecular Formula | C22H40O |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 320.31 |
| IUPAC Name | (E)-non-2-ene;2-[(E)-oct-2-enyl]cyclopentan-1-one |
| SMILES | C/C=C/CCCCCC.CCCCC/C=C/CC1CCCC1=O |
| InChI | InChI=1S/C13H22O.C9H18/c1-2-3-4-5-6-7-9-12-10-8-11-13(12)14;1-3-5-7-9-8-6-4-2/h6-7,12H,2-5,8-11H2,1H3;3,5H,4,6-9H2,1-2H3/b7-6+;5-3+ |
| InChIKey | MUDODVBXAGMWLY-QVLDUDGTSA-N |
| XLogP | 7.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-non-2-ene;2-[(E)-oct-2-enyl]cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-non-2-ene;2-[(E)-oct-2-enyl]cyclopentan-1-one?
The IUPAC name of (E)-non-2-ene;2-[(E)-oct-2-enyl]cyclopentan-1-one (CID 174922472) is (E)-non-2-ene;2-[(E)-oct-2-enyl]cyclopentan-1-one.
What is the SMILES notation for (E)-non-2-ene;2-[(E)-oct-2-enyl]cyclopentan-1-one?
The canonical SMILES for (E)-non-2-ene;2-[(E)-oct-2-enyl]cyclopentan-1-one is C/C=C/CCCCCC.CCCCC/C=C/CC1CCCC1=O.
What is the InChIKey of (E)-non-2-ene;2-[(E)-oct-2-enyl]cyclopentan-1-one?
The InChIKey is MUDODVBXAGMWLY-QVLDUDGTSA-N. The full InChI is InChI=1S/C13H22O.C9H18/c1-2-3-4-5-6-7-9-12-10-8-11-13(12)14;1-3-5-7-9-8-6-4-2/h6-7,12H,2-5,8-11H2,1H3;3,5H,4,6-9H2,1-2H3/b7-6+;5-3+.
What are the key properties of (E)-non-2-ene;2-[(E)-oct-2-enyl]cyclopentan-1-one?
(E)-non-2-ene;2-[(E)-oct-2-enyl]cyclopentan-1-one has a molecular weight of 320.56 g/mol, XLogP of 7.42, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-non-2-ene;2-[(E)-oct-2-enyl]cyclopentan-1-one is sourced from PubChem (CID 174922472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).