About dec-2-ene;oxolane-2,5-dione
dec-2-ene;oxolane-2,5-dione (PubChem CID 175141022) has the molecular formula C14H24O3
and a molecular weight of 240.34 g/mol. Its IUPAC name is dec-2-ene;oxolane-2,5-dione.
Molecular Properties
| Compound Name | dec-2-ene;oxolane-2,5-dione |
| PubChem CID | 175141022 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | dec-2-ene;oxolane-2,5-dione |
| SMILES | CC=CCCCCCCC.O=C1CCC(=O)O1 |
| InChI | InChI=1S/C10H20.C4H4O3/c1-3-5-7-9-10-8-6-4-2;5-3-1-2-4(6)7-3/h3,5H,4,6-10H2,1-2H3;1-2H2 |
| InChIKey | DBAUUQHNNHDGOA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dec-2-ene;oxolane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-2-ene;oxolane-2,5-dione?
The IUPAC name of dec-2-ene;oxolane-2,5-dione (CID 175141022) is dec-2-ene;oxolane-2,5-dione.
What is the SMILES notation for dec-2-ene;oxolane-2,5-dione?
The canonical SMILES for dec-2-ene;oxolane-2,5-dione is CC=CCCCCCCC.O=C1CCC(=O)O1.
What is the InChIKey of dec-2-ene;oxolane-2,5-dione?
The InChIKey is DBAUUQHNNHDGOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20.C4H4O3/c1-3-5-7-9-10-8-6-4-2;5-3-1-2-4(6)7-3/h3,5H,4,6-10H2,1-2H3;1-2H2.
What are the key properties of dec-2-ene;oxolane-2,5-dione?
dec-2-ene;oxolane-2,5-dione has a molecular weight of 240.34 g/mol, XLogP of 3.77, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dec-2-ene;oxolane-2,5-dione is sourced from PubChem (CID 175141022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).