C16H22O7 — CID 139778450
3-hydroxy-3-[(E)-oct-1-enyl]-1,6-dioxecane-2,5,7,10-tetrone (PubChem CID 139778450) has the molecular formula C16H22O7 and a molecular weight of 326.35 g/mol. Its IUPAC name is 3-hydroxy-3-[(E)-oct-1-enyl]-1,6-dioxecane-2,5,7,10-tetrone.
| Compound Name | 3-hydroxy-3-[(E)-oct-1-enyl]-1,6-dioxecane-2,5,7,10-tetrone |
|---|---|
| PubChem CID | 139778450 |
| Molecular Formula | C16H22O7 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 3-hydroxy-3-[(E)-oct-1-enyl]-1,6-dioxecane-2,5,7,10-tetrone |
| SMILES | CCCCCC/C=C/C1(O)CC(=O)OC(=O)CCC(=O)OC1=O |
| InChI | InChI=1S/C16H22O7/c1-2-3-4-5-6-7-10-16(21)11-14(19)22-12(17)8-9-13(18)23-15(16)20/h7,10,21H,2-6,8-9,11H2,1H3/b10-7+ |
| InChIKey | URQRMEKMLVERLR-JXMROGBWSA-N |
| XLogP | 1.57 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|