C14H18O7 — CID 139778448
3-[(E)-hex-2-enyl]-3-hydroxy-1,6-dioxecane-2,5,7,10-tetrone (PubChem CID 139778448) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is 3-[(E)-hex-2-enyl]-3-hydroxy-1,6-dioxecane-2,5,7,10-tetrone.
| Compound Name | 3-[(E)-hex-2-enyl]-3-hydroxy-1,6-dioxecane-2,5,7,10-tetrone |
|---|---|
| PubChem CID | 139778448 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-[(E)-hex-2-enyl]-3-hydroxy-1,6-dioxecane-2,5,7,10-tetrone |
| SMILES | CCC/C=C/CC1(O)CC(=O)OC(=O)CCC(=O)OC1=O |
| InChI | InChI=1S/C14H18O7/c1-2-3-4-5-8-14(19)9-12(17)20-10(15)6-7-11(16)21-13(14)18/h4-5,19H,2-3,6-9H2,1H3/b5-4+ |
| InChIKey | MNNDRFJFJSWSDK-SNAWJCMRSA-N |
| XLogP | 0.79 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|