C17H21FN2O4 — CID 112774564
2-(2-acetyl-4-fluorophenoxy)-N-(cyclohexylcarbamoyl)acetamide (PubChem CID 112774564) has the molecular formula C17H21FN2O4 and a molecular weight of 336.36 g/mol. Its IUPAC name is 2-(2-acetyl-4-fluorophenoxy)-N-(cyclohexylcarbamoyl)acetamide.
| Compound Name | 2-(2-acetyl-4-fluorophenoxy)-N-(cyclohexylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 112774564 |
| Molecular Formula | C17H21FN2O4 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-(2-acetyl-4-fluorophenoxy)-N-(cyclohexylcarbamoyl)acetamide |
| SMILES | CC(=O)c1cc(F)ccc1OCC(=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H21FN2O4/c1-11(21)14-9-12(18)7-8-15(14)24-10-16(22)20-17(23)19-13-5-3-2-4-6-13/h7-9,13H,2-6,10H2,1H3,(H2,19,20,22,23) |
| InChIKey | BYNQRWFEASJWCW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |