C17H28O3 — CID 11277482
[2-[(1R,3aS,7aS)-1,4,4,7a-tetramethyl-2,3,3a,5,6,7-hexahydroinden-1-yl]-2-oxoethyl] acetate (PubChem CID 11277482) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is [2-[(1R,3aS,7aS)-1,4,4,7a-tetramethyl-2,3,3a,5,6,7-hexahydroinden-1-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(1R,3aS,7aS)-1,4,4,7a-tetramethyl-2,3,3a,5,6,7-hexahydroinden-1-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 11277482 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | [2-[(1R,3aS,7aS)-1,4,4,7a-tetramethyl-2,3,3a,5,6,7-hexahydroinden-1-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@]1(C)CC[C@H]2C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C17H28O3/c1-12(18)20-11-14(19)17(5)10-7-13-15(2,3)8-6-9-16(13,17)4/h13H,6-11H2,1-5H3/t13-,16-,17-/m0/s1 |
| InChIKey | LAIZPIZRUDATMB-JQFCIGGWSA-N |
| XLogP | 3.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |