C17H28O3 — CID 101048228
[(1R,2R,3aR,7aR)-1-formyl-3a,7,7,7a-tetramethyl-1,2,3,4,5,6-hexahydroinden-2-yl]methyl acetate (PubChem CID 101048228) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is [(1R,2R,3aR,7aR)-1-formyl-3a,7,7,7a-tetramethyl-1,2,3,4,5,6-hexahydroinden-2-yl]methyl acetate.
| Compound Name | [(1R,2R,3aR,7aR)-1-formyl-3a,7,7,7a-tetramethyl-1,2,3,4,5,6-hexahydroinden-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101048228 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | [(1R,2R,3aR,7aR)-1-formyl-3a,7,7,7a-tetramethyl-1,2,3,4,5,6-hexahydroinden-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1C[C@@]2(C)CCCC(C)(C)[C@@]2(C)[C@@H]1C=O |
| InChI | InChI=1S/C17H28O3/c1-12(19)20-11-13-9-16(4)8-6-7-15(2,3)17(16,5)14(13)10-18/h10,13-14H,6-9,11H2,1-5H3/t13-,14+,16+,17+/m0/s1 |
| InChIKey | XGLZSWGCQCTELV-XOSAIJSUSA-N |
| XLogP | 3.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|