C19H17ClN4O4S — CID 112776094
N-(2-chloro-5-nitrophenyl)-2-(8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yloxy)acetamide (PubChem CID 112776094) has the molecular formula C19H17ClN4O4S and a molecular weight of 432.89 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-2-(8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yloxy)acetamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-2-(8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yloxy)acetamide |
|---|---|
| PubChem CID | 112776094 |
| Molecular Formula | C19H17ClN4O4S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-2-(8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-yloxy)acetamide |
| SMILES | O=C(COc1ncnc2sc3c(c12)CCCCC3)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C19H17ClN4O4S/c20-13-7-6-11(24(26)27)8-14(13)23-16(25)9-28-18-17-12-4-2-1-3-5-15(12)29-19(17)22-10-21-18/h6-8,10H,1-5,9H2,(H,23,25) |
| InChIKey | MMQNYQHSJCRIPL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|