C15H11N3O3S — CID 9213110
12-(4-nitrophenoxy)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene (PubChem CID 9213110) has the molecular formula C15H11N3O3S and a molecular weight of 313.34 g/mol. Its IUPAC name is 12-(4-nitrophenoxy)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene.
| Compound Name | 12-(4-nitrophenoxy)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
|---|---|
| PubChem CID | 9213110 |
| Molecular Formula | C15H11N3O3S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 12-(4-nitrophenoxy)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
| SMILES | O=[N+]([O-])c1ccc(Oc2ncnc3sc4c(c23)CCC4)cc1 |
| InChI | InChI=1S/C15H11N3O3S/c19-18(20)9-4-6-10(7-5-9)21-14-13-11-2-1-3-12(11)22-15(13)17-8-16-14/h4-8H,1-3H2 |
| InChIKey | GCAPQTWZJZHFDK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|