C22H15N3O2S — CID 8840597
2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yloxy)-10H-acridin-9-one (PubChem CID 8840597) has the molecular formula C22H15N3O2S and a molecular weight of 385.45 g/mol. Its IUPAC name is 2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yloxy)-10H-acridin-9-one.
| Compound Name | 2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yloxy)-10H-acridin-9-one |
|---|---|
| PubChem CID | 8840597 |
| Molecular Formula | C22H15N3O2S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 2-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yloxy)-10H-acridin-9-one |
| SMILES | O=c1c2ccccc2[nH]c2ccc(Oc3ncnc4sc5c(c34)CCC5)cc12 |
| InChI | InChI=1S/C22H15N3O2S/c26-20-13-4-1-2-6-16(13)25-17-9-8-12(10-15(17)20)27-21-19-14-5-3-7-18(14)28-22(19)24-11-23-21/h1-2,4,6,8-11H,3,5,7H2,(H,25,26) |
| InChIKey | BGJVVIDWJVFUKF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|