C20H19N5S — CID 91055746
(2-methyl-1H-indol-3-yl)methyl-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)diazene (PubChem CID 91055746) has the molecular formula C20H19N5S and a molecular weight of 361.47 g/mol. Its IUPAC name is (2-methyl-1H-indol-3-yl)methyl-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)diazene.
| Compound Name | (2-methyl-1H-indol-3-yl)methyl-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)diazene |
|---|---|
| PubChem CID | 91055746 |
| Molecular Formula | C20H19N5S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (2-methyl-1H-indol-3-yl)methyl-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)diazene |
| SMILES | Cc1[nH]c2ccccc2c1C/N=N/c1ncnc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C20H19N5S/c1-12-15(13-6-2-4-8-16(13)24-12)10-23-25-19-18-14-7-3-5-9-17(14)26-20(18)22-11-21-19/h2,4,6,8,11,24H,3,5,7,9-10H2,1H3/b25-23+ |
| InChIKey | KNXONRHLNNGVFF-WJTDDFOZSA-N |
| XLogP | 5.64 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|