C17H15BrN4S — CID 91065891
(4-bromophenyl)methyl-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)diazene (PubChem CID 91065891) has the molecular formula C17H15BrN4S and a molecular weight of 387.31 g/mol. Its IUPAC name is (4-bromophenyl)methyl-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)diazene.
| Compound Name | (4-bromophenyl)methyl-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)diazene |
|---|---|
| PubChem CID | 91065891 |
| Molecular Formula | C17H15BrN4S |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | (4-bromophenyl)methyl-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)diazene |
| SMILES | Brc1ccc(C/N=N/c2ncnc3sc4c(c23)CCCC4)cc1 |
| InChI | InChI=1S/C17H15BrN4S/c18-12-7-5-11(6-8-12)9-21-22-16-15-13-3-1-2-4-14(13)23-17(15)20-10-19-16/h5-8,10H,1-4,9H2/b22-21+ |
| InChIKey | WDAJBYRLVFPKDN-QURGRASLSA-N |
| XLogP | 5.62 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|