C17H14BrN3S — CID 133471683
12-(5-bromo-1,3-dihydroisoindol-2-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene (PubChem CID 133471683) has the molecular formula C17H14BrN3S and a molecular weight of 372.29 g/mol. Its IUPAC name is 12-(5-bromo-1,3-dihydroisoindol-2-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene.
| Compound Name | 12-(5-bromo-1,3-dihydroisoindol-2-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
|---|---|
| PubChem CID | 133471683 |
| Molecular Formula | C17H14BrN3S |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 12-(5-bromo-1,3-dihydroisoindol-2-yl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
| SMILES | Brc1ccc2c(c1)CN(c1ncnc3sc4c(c13)CCC4)C2 |
| InChI | InChI=1S/C17H14BrN3S/c18-12-5-4-10-7-21(8-11(10)6-12)16-15-13-2-1-3-14(13)22-17(15)20-9-19-16/h4-6,9H,1-3,7-8H2 |
| InChIKey | GTELGDQDTLKIKZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |