C18H15N5S — CID 91552176
4-[(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yldiazenyl)methyl]benzonitrile (PubChem CID 91552176) has the molecular formula C18H15N5S and a molecular weight of 333.42 g/mol. Its IUPAC name is 4-[(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yldiazenyl)methyl]benzonitrile.
| Compound Name | 4-[(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yldiazenyl)methyl]benzonitrile |
|---|---|
| PubChem CID | 91552176 |
| Molecular Formula | C18H15N5S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 4-[(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yldiazenyl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(C/N=N/c2ncnc3sc4c(c23)CCCC4)cc1 |
| InChI | InChI=1S/C18H15N5S/c19-9-12-5-7-13(8-6-12)10-22-23-17-16-14-3-1-2-4-15(14)24-18(16)21-11-20-17/h5-8,11H,1-4,10H2/b23-22+ |
| InChIKey | AWFAINNSVRYIIT-GHVJWSGMSA-N |
| XLogP | 4.73 |
| TPSA | 74.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|