C18H23NO3 — CID 11278022
(4R)-3-[(E,5S)-5-methyloct-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 11278022) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is (4R)-3-[(E,5S)-5-methyloct-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(E,5S)-5-methyloct-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11278022 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | (4R)-3-[(E,5S)-5-methyloct-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CCC[C@H](C)C/C=C/C(=O)N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H23NO3/c1-3-8-14(2)9-7-12-17(20)19-16(13-22-18(19)21)15-10-5-4-6-11-15/h4-7,10-12,14,16H,3,8-9,13H2,1-2H3/b12-7+/t14-,16-/m0/s1 |
| InChIKey | QIWRPZJUOQFEGM-CMIZMYSDSA-N |
| XLogP | 4.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|