C18H25F3N2O2S — CID 112781252
2-butylsulfanyl-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]propanamide (PubChem CID 112781252) has the molecular formula C18H25F3N2O2S and a molecular weight of 390.47 g/mol. Its IUPAC name is 2-butylsulfanyl-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-butylsulfanyl-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 112781252 |
| Molecular Formula | C18H25F3N2O2S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2-butylsulfanyl-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]propanamide |
| SMILES | CCCCSC(C)C(=O)Nc1cc(C(F)(F)F)ccc1N1CCOCC1 |
| InChI | InChI=1S/C18H25F3N2O2S/c1-3-4-11-26-13(2)17(24)22-15-12-14(18(19,20)21)5-6-16(15)23-7-9-25-10-8-23/h5-6,12-13H,3-4,7-11H2,1-2H3,(H,22,24) |
| InChIKey | NMLQOLSXNBVNLN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|