C16H14BrNO2S — CID 112781455
2-(3-bromophenoxy)-1-(2,3-dihydro-1,4-benzothiazin-4-yl)ethanone (PubChem CID 112781455) has the molecular formula C16H14BrNO2S and a molecular weight of 364.26 g/mol. Its IUPAC name is 2-(3-bromophenoxy)-1-(2,3-dihydro-1,4-benzothiazin-4-yl)ethanone.
| Compound Name | 2-(3-bromophenoxy)-1-(2,3-dihydro-1,4-benzothiazin-4-yl)ethanone |
|---|---|
| PubChem CID | 112781455 |
| Molecular Formula | C16H14BrNO2S |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | 2-(3-bromophenoxy)-1-(2,3-dihydro-1,4-benzothiazin-4-yl)ethanone |
| SMILES | O=C(COc1cccc(Br)c1)N1CCSc2ccccc21 |
| InChI | InChI=1S/C16H14BrNO2S/c17-12-4-3-5-13(10-12)20-11-16(19)18-8-9-21-15-7-2-1-6-14(15)18/h1-7,10H,8-9,11H2 |
| InChIKey | WOLGSYPVBQMSIE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |