C15H12BrNOS — CID 51155277
(3-bromophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone (PubChem CID 51155277) has the molecular formula C15H12BrNOS and a molecular weight of 334.24 g/mol. Its IUPAC name is (3-bromophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone.
| Compound Name | (3-bromophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone |
|---|---|
| PubChem CID | 51155277 |
| Molecular Formula | C15H12BrNOS |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | (3-bromophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone |
| SMILES | O=C(c1cccc(Br)c1)N1CCSc2ccccc21 |
| InChI | InChI=1S/C15H12BrNOS/c16-12-5-3-4-11(10-12)15(18)17-8-9-19-14-7-2-1-6-13(14)17/h1-7,10H,8-9H2 |
| InChIKey | IISJVNBYKBZTBP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |