C15H11ClINOS — CID 103221344
(3-chloro-4-iodophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone (PubChem CID 103221344) has the molecular formula C15H11ClINOS and a molecular weight of 415.68 g/mol. Its IUPAC name is (3-chloro-4-iodophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone.
| Compound Name | (3-chloro-4-iodophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone |
|---|---|
| PubChem CID | 103221344 |
| Molecular Formula | C15H11ClINOS |
| Molecular Weight | 415.68 g/mol |
| Exact Mass | 414.93 |
| IUPAC Name | (3-chloro-4-iodophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone |
| SMILES | O=C(c1ccc(I)c(Cl)c1)N1CCSc2ccccc21 |
| InChI | InChI=1S/C15H11ClINOS/c16-11-9-10(5-6-12(11)17)15(19)18-7-8-20-14-4-2-1-3-13(14)18/h1-6,9H,7-8H2 |
| InChIKey | MYKSYHSPWLDLJM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.68 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|