C14H11BrN2OS — CID 103756375
(2-bromo-4-pyridinyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone (PubChem CID 103756375) has the molecular formula C14H11BrN2OS and a molecular weight of 335.23 g/mol. Its IUPAC name is (2-bromo-4-pyridinyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone.
| Compound Name | (2-bromo-4-pyridinyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone |
|---|---|
| PubChem CID | 103756375 |
| Molecular Formula | C14H11BrN2OS |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | (2-bromo-4-pyridinyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone |
| SMILES | O=C(c1ccnc(Br)c1)N1CCSc2ccccc21 |
| InChI | InChI=1S/C14H11BrN2OS/c15-13-9-10(5-6-16-13)14(18)17-7-8-19-12-4-2-1-3-11(12)17/h1-6,9H,7-8H2 |
| InChIKey | YZNSNNUHPOZIOT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|