C37H28Cl4N2O4S2 — CID 159122153
(3,5-dichloro-4-hydroxyphenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone;(3,5-dichloro-4-phenylmethoxyphenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone (PubChem CID 159122153) has the molecular formula C37H28Cl4N2O4S2 and a molecular weight of 770.59 g/mol. Its IUPAC name is (3,5-dichloro-4-hydroxyphenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone;(3,5-dichloro-4-phenylmethoxyphenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone.
| Compound Name | (3,5-dichloro-4-hydroxyphenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone;(3,5-dichloro-4-phenylmethoxyphenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone |
|---|---|
| PubChem CID | 159122153 |
| Molecular Formula | C37H28Cl4N2O4S2 |
| Molecular Weight | 770.59 g/mol |
| Exact Mass | 768.02 |
| IUPAC Name | (3,5-dichloro-4-hydroxyphenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone;(3,5-dichloro-4-phenylmethoxyphenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone |
| SMILES | O=C(c1cc(Cl)c(O)c(Cl)c1)N1CCSc2ccccc21.O=C(c1cc(Cl)c(OCc2ccccc2)c(Cl)c1)N1CCSc2ccccc21 |
| InChI | InChI=1S/C22H17Cl2NO2S.C15H11Cl2NO2S/c23-17-12-16(13-18(24)21(17)27-14-15-6-2-1-3-7-15)22(26)25-10-11-28-20-9-5-4-8-19(20)25;16-10-7-9(8-11(17)14(10)19)15(20)18-5-6-21-13-4-2-1-3-12(13)18/h1-9,12-13H,10-11,14H2;1-4,7-8,19H,5-6H2 |
| InChIKey | KFVFIHOWBAXENS-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.59 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |