C20H23N3O2S — CID 112785901
3-cyclopropyl-5-[2-(2,6-dimethylphenoxy)ethylsulfanyl]-4-(furan-2-ylmethyl)-1,2,4-triazole (PubChem CID 112785901) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is 3-cyclopropyl-5-[2-(2,6-dimethylphenoxy)ethylsulfanyl]-4-(furan-2-ylmethyl)-1,2,4-triazole.
| Compound Name | 3-cyclopropyl-5-[2-(2,6-dimethylphenoxy)ethylsulfanyl]-4-(furan-2-ylmethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 112785901 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 3-cyclopropyl-5-[2-(2,6-dimethylphenoxy)ethylsulfanyl]-4-(furan-2-ylmethyl)-1,2,4-triazole |
| SMILES | Cc1cccc(C)c1OCCSc1nnc(C2CC2)n1Cc1ccco1 |
| InChI | InChI=1S/C20H23N3O2S/c1-14-5-3-6-15(2)18(14)25-11-12-26-20-22-21-19(16-8-9-16)23(20)13-17-7-4-10-24-17/h3-7,10,16H,8-9,11-13H2,1-2H3 |
| InChIKey | KRNCVQHJQTZQPF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|