C19H17NO2S — CID 11278748
(E)-1-[(4S,5R)-4-methyl-5-phenyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-phenylprop-2-en-1-one (PubChem CID 11278748) has the molecular formula C19H17NO2S and a molecular weight of 323.42 g/mol. Its IUPAC name is (E)-1-[(4S,5R)-4-methyl-5-phenyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[(4S,5R)-4-methyl-5-phenyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 11278748 |
| Molecular Formula | C19H17NO2S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | (E)-1-[(4S,5R)-4-methyl-5-phenyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3-phenylprop-2-en-1-one |
| SMILES | C[C@H]1[C@@H](c2ccccc2)OC(=S)N1C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H17NO2S/c1-14-18(16-10-6-3-7-11-16)22-19(23)20(14)17(21)13-12-15-8-4-2-5-9-15/h2-14,18H,1H3/b13-12+/t14-,18-/m0/s1 |
| InChIKey | ITSRFYCRBNXLFW-RMCBBKKWSA-N |
| XLogP | 3.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|