C16H12F4N2O — CID 112787945
1-[(3-fluoro-4-methoxyphenyl)methyl]-2-(trifluoromethyl)benzimidazole (PubChem CID 112787945) has the molecular formula C16H12F4N2O and a molecular weight of 324.28 g/mol. Its IUPAC name is 1-[(3-fluoro-4-methoxyphenyl)methyl]-2-(trifluoromethyl)benzimidazole.
| Compound Name | 1-[(3-fluoro-4-methoxyphenyl)methyl]-2-(trifluoromethyl)benzimidazole |
|---|---|
| PubChem CID | 112787945 |
| Molecular Formula | C16H12F4N2O |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 1-[(3-fluoro-4-methoxyphenyl)methyl]-2-(trifluoromethyl)benzimidazole |
| SMILES | COc1ccc(Cn2c(C(F)(F)F)nc3ccccc32)cc1F |
| InChI | InChI=1S/C16H12F4N2O/c1-23-14-7-6-10(8-11(14)17)9-22-13-5-3-2-4-12(13)21-15(22)16(18,19)20/h2-8H,9H2,1H3 |
| InChIKey | JHODUIWQVDSSON-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |