C17H19FN4OS — CID 112789374
3-(4-fluorophenyl)sulfanyl-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one (PubChem CID 112789374) has the molecular formula C17H19FN4OS and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfanyl-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one.
| Compound Name | 3-(4-fluorophenyl)sulfanyl-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 112789374 |
| Molecular Formula | C17H19FN4OS |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 3-(4-fluorophenyl)sulfanyl-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one |
| SMILES | O=C(CCSc1ccc(F)cc1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H19FN4OS/c18-14-2-4-15(5-3-14)24-13-6-16(23)21-9-11-22(12-10-21)17-19-7-1-8-20-17/h1-5,7-8H,6,9-13H2 |
| InChIKey | CVGBKQSXJJTHMP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |