C17H26N2O3 — CID 112791371
1-(4-methyl-1,4-diazepan-1-yl)-2-(4-propoxyphenoxy)ethanone (PubChem CID 112791371) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-(4-methyl-1,4-diazepan-1-yl)-2-(4-propoxyphenoxy)ethanone.
| Compound Name | 1-(4-methyl-1,4-diazepan-1-yl)-2-(4-propoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 112791371 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-(4-methyl-1,4-diazepan-1-yl)-2-(4-propoxyphenoxy)ethanone |
| SMILES | CCCOc1ccc(OCC(=O)N2CCCN(C)CC2)cc1 |
| InChI | InChI=1S/C17H26N2O3/c1-3-13-21-15-5-7-16(8-6-15)22-14-17(20)19-10-4-9-18(2)11-12-19/h5-8H,3-4,9-14H2,1-2H3 |
| InChIKey | SMQTXRHGQWCYQW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |