C21H20Cl2N2O2 — CID 112793678
N-[2-(2,4-dichlorophenyl)-2-(1H-indol-3-yl)ethyl]oxolane-2-carboxamide (PubChem CID 112793678) has the molecular formula C21H20Cl2N2O2 and a molecular weight of 403.31 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)-2-(1H-indol-3-yl)ethyl]oxolane-2-carboxamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)-2-(1H-indol-3-yl)ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 112793678 |
| Molecular Formula | C21H20Cl2N2O2 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)-2-(1H-indol-3-yl)ethyl]oxolane-2-carboxamide |
| SMILES | O=C(NCC(c1ccc(Cl)cc1Cl)c1c[nH]c2ccccc12)C1CCCO1 |
| InChI | InChI=1S/C21H20Cl2N2O2/c22-13-7-8-14(18(23)10-13)16(12-25-21(26)20-6-3-9-27-20)17-11-24-19-5-2-1-4-15(17)19/h1-2,4-5,7-8,10-11,16,20,24H,3,6,9,12H2,(H,25,26) |
| InChIKey | JAJVLIYOOOXSOE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |