C25H22Cl2N4O2 — CID 112818253
3-[[[2-(2,4-dichlorophenyl)-2-(1H-indol-3-yl)ethyl]carbamoylamino]methyl]benzamide (PubChem CID 112818253) has the molecular formula C25H22Cl2N4O2 and a molecular weight of 481.38 g/mol. Its IUPAC name is 3-[[[2-(2,4-dichlorophenyl)-2-(1H-indol-3-yl)ethyl]carbamoylamino]methyl]benzamide.
| Compound Name | 3-[[[2-(2,4-dichlorophenyl)-2-(1H-indol-3-yl)ethyl]carbamoylamino]methyl]benzamide |
|---|---|
| PubChem CID | 112818253 |
| Molecular Formula | C25H22Cl2N4O2 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 3-[[[2-(2,4-dichlorophenyl)-2-(1H-indol-3-yl)ethyl]carbamoylamino]methyl]benzamide |
| SMILES | NC(=O)c1cccc(CNC(=O)NCC(c2ccc(Cl)cc2Cl)c2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C25H22Cl2N4O2/c26-17-8-9-18(22(27)11-17)20(21-13-29-23-7-2-1-6-19(21)23)14-31-25(33)30-12-15-4-3-5-16(10-15)24(28)32/h1-11,13,20,29H,12,14H2,(H2,28,32)(H2,30,31,33) |
| InChIKey | YOGFFKVZYHFODI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |