C10H16N2OS — CID 112794692
4-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)pentanamide (PubChem CID 112794692) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 4-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)pentanamide.
| Compound Name | 4-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)pentanamide |
|---|---|
| PubChem CID | 112794692 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 4-methyl-N-(3-methyl-1,3-thiazol-2-ylidene)pentanamide |
| SMILES | CC(C)CCC(=O)/N=c1\sccn1C |
| InChI | InChI=1S/C10H16N2OS/c1-8(2)4-5-9(13)11-10-12(3)6-7-14-10/h6-8H,4-5H2,1-3H3/b11-10- |
| InChIKey | QFWOVKVWJATSPJ-KHPPLWFESA-N |
| XLogP | 1.95 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |