C17H19NO7 — CID 11279509
(1S,2R,6R,7R,9R,12R)-5-acetyl-7-methoxy-12-phenyl-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-4-one (PubChem CID 11279509) has the molecular formula C17H19NO7 and a molecular weight of 349.34 g/mol. Its IUPAC name is (1S,2R,6R,7R,9R,12R)-5-acetyl-7-methoxy-12-phenyl-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-4-one.
| Compound Name | (1S,2R,6R,7R,9R,12R)-5-acetyl-7-methoxy-12-phenyl-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-4-one |
|---|---|
| PubChem CID | 11279509 |
| Molecular Formula | C17H19NO7 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (1S,2R,6R,7R,9R,12R)-5-acetyl-7-methoxy-12-phenyl-3,8,11,13-tetraoxa-5-azatricyclo[7.4.0.02,6]tridecan-4-one |
| SMILES | CO[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H]2OC(=O)N(C(C)=O)[C@@H]12 |
| InChI | InChI=1S/C17H19NO7/c1-9(19)18-12-14(25-17(18)20)13-11(23-16(12)21-2)8-22-15(24-13)10-6-4-3-5-7-10/h3-7,11-16H,8H2,1-2H3/t11-,12-,13-,14-,15-,16-/m1/s1 |
| InChIKey | FCXNETUGNBBYHA-VUVWGQCBSA-N |
| XLogP | 1.21 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |