C16H15BrN4O3S — CID 112795427
N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 112795427) has the molecular formula C16H15BrN4O3S and a molecular weight of 423.29 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 112795427 |
| Molecular Formula | C16H15BrN4O3S |
| Molecular Weight | 423.29 g/mol |
| Exact Mass | 422.00 |
| IUPAC Name | N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | Cc1sc(NC(=O)CN2C(=O)CN(C)C2=O)nc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H15BrN4O3S/c1-9-14(10-3-5-11(17)6-4-10)19-15(25-9)18-12(22)7-21-13(23)8-20(2)16(21)24/h3-6H,7-8H2,1-2H3,(H,18,19,22) |
| InChIKey | ONTPEXPJNYCHRW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|