C20H32N4O3 — CID 112796880
5-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)acetyl]-6-amino-3-methyl-1-(2-methylpropyl)pyrimidine-2,4-dione (PubChem CID 112796880) has the molecular formula C20H32N4O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is 5-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)acetyl]-6-amino-3-methyl-1-(2-methylpropyl)pyrimidine-2,4-dione.
| Compound Name | 5-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)acetyl]-6-amino-3-methyl-1-(2-methylpropyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 112796880 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 5-[2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)acetyl]-6-amino-3-methyl-1-(2-methylpropyl)pyrimidine-2,4-dione |
| SMILES | CC(C)Cn1c(N)c(C(=O)CN2CCCC3CCCCC32)c(=O)n(C)c1=O |
| InChI | InChI=1S/C20H32N4O3/c1-13(2)11-24-18(21)17(19(26)22(3)20(24)27)16(25)12-23-10-6-8-14-7-4-5-9-15(14)23/h13-15H,4-12,21H2,1-3H3 |
| InChIKey | LVVIMASPRLTXEB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |