C18H28N4O3 — CID 11931412
5-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]acetyl]-6-amino-1-propylpyrimidine-2,4-dione (PubChem CID 11931412) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 5-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]acetyl]-6-amino-1-propylpyrimidine-2,4-dione.
| Compound Name | 5-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]acetyl]-6-amino-1-propylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11931412 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 5-[2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]acetyl]-6-amino-1-propylpyrimidine-2,4-dione |
| SMILES | CCCn1c(N)c(C(=O)CN2CCC[C@H]3CCCC[C@@H]32)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H28N4O3/c1-2-9-22-16(19)15(17(24)20-18(22)25)14(23)11-21-10-5-7-12-6-3-4-8-13(12)21/h12-13H,2-11,19H2,1H3,(H,20,24,25)/t12-,13+/m1/s1 |
| InChIKey | YOQYIVCBJHNJAE-OLZOCXBDSA-N |
| XLogP | 1.37 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |