C14H22N4O3S2 — CID 7841465
[2-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-2-oxoethyl] N,N-diethylcarbamodithioate (PubChem CID 7841465) has the molecular formula C14H22N4O3S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is [2-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-2-oxoethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-2-oxoethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 7841465 |
| Molecular Formula | C14H22N4O3S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | [2-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-2-oxoethyl] N,N-diethylcarbamodithioate |
| SMILES | CCCn1c(N)c(C(=O)CSC(=S)N(CC)CC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H22N4O3S2/c1-4-7-18-11(15)10(12(20)16-13(18)21)9(19)8-23-14(22)17(5-2)6-3/h4-8,15H2,1-3H3,(H,16,20,21) |
| InChIKey | DPBINQQKTLIQKA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|