C8H10ClN3O3 — CID 4962458
6-amino-5-(2-chloroacetyl)-1-ethylpyrimidine-2,4-dione (PubChem CID 4962458) has the molecular formula C8H10ClN3O3 and a molecular weight of 231.64 g/mol. Its IUPAC name is 6-amino-5-(2-chloroacetyl)-1-ethylpyrimidine-2,4-dione.
| Compound Name | 6-amino-5-(2-chloroacetyl)-1-ethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4962458 |
| Molecular Formula | C8H10ClN3O3 |
| Molecular Weight | 231.64 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 6-amino-5-(2-chloroacetyl)-1-ethylpyrimidine-2,4-dione |
| SMILES | CCn1c(N)c(C(=O)CCl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H10ClN3O3/c1-2-12-6(10)5(4(13)3-9)7(14)11-8(12)15/h2-3,10H2,1H3,(H,11,14,15) |
| InChIKey | XVUGGWIEWONRKX-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.64 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|