C6H8F3N3O — CID 82400681
4-amino-3-ethyl-5-(trifluoromethyl)-1H-imidazol-2-one (PubChem CID 82400681) has the molecular formula C6H8F3N3O and a molecular weight of 195.14 g/mol. Its IUPAC name is 4-amino-3-ethyl-5-(trifluoromethyl)-1H-imidazol-2-one.
| Compound Name | 4-amino-3-ethyl-5-(trifluoromethyl)-1H-imidazol-2-one |
|---|---|
| PubChem CID | 82400681 |
| Molecular Formula | C6H8F3N3O |
| Molecular Weight | 195.14 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 4-amino-3-ethyl-5-(trifluoromethyl)-1H-imidazol-2-one |
| SMILES | CCn1c(N)c(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C6H8F3N3O/c1-2-12-4(10)3(6(7,8)9)11-5(12)13/h2,10H2,1H3,(H,11,13) |
| InChIKey | BZHILEQTPNSMJF-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 63.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.14 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |