C24H32N4O3 — CID 112797261
N-[2-(2-ethylanilino)-2-oxoethyl]-2-[(2-morpholin-4-yl-1-phenylethyl)amino]acetamide (PubChem CID 112797261) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is N-[2-(2-ethylanilino)-2-oxoethyl]-2-[(2-morpholin-4-yl-1-phenylethyl)amino]acetamide.
| Compound Name | N-[2-(2-ethylanilino)-2-oxoethyl]-2-[(2-morpholin-4-yl-1-phenylethyl)amino]acetamide |
|---|---|
| PubChem CID | 112797261 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | N-[2-(2-ethylanilino)-2-oxoethyl]-2-[(2-morpholin-4-yl-1-phenylethyl)amino]acetamide |
| SMILES | CCc1ccccc1NC(=O)CNC(=O)CNC(CN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C24H32N4O3/c1-2-19-8-6-7-11-21(19)27-24(30)17-26-23(29)16-25-22(20-9-4-3-5-10-20)18-28-12-14-31-15-13-28/h3-11,22,25H,2,12-18H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | VLRGNGGQNNVSLI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |