C22H34N4O3 — CID 78899179
N-(2-ethylphenyl)-2-[[2-[4-(morpholin-4-ylmethyl)piperidin-1-yl]acetyl]amino]acetamide (PubChem CID 78899179) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[[2-[4-(morpholin-4-ylmethyl)piperidin-1-yl]acetyl]amino]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[[2-[4-(morpholin-4-ylmethyl)piperidin-1-yl]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 78899179 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | N-(2-ethylphenyl)-2-[[2-[4-(morpholin-4-ylmethyl)piperidin-1-yl]acetyl]amino]acetamide |
| SMILES | CCc1ccccc1NC(=O)CNC(=O)CN1CCC(CN2CCOCC2)CC1 |
| InChI | InChI=1S/C22H34N4O3/c1-2-19-5-3-4-6-20(19)24-21(27)15-23-22(28)17-25-9-7-18(8-10-25)16-26-11-13-29-14-12-26/h3-6,18H,2,7-17H2,1H3,(H,23,28)(H,24,27) |
| InChIKey | VIIISAUGXVPFBN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |