C20H29N3O3 — CID 55501528
N-(2-ethylphenyl)-2-[3-(morpholine-4-carbonyl)piperidin-1-yl]acetamide (PubChem CID 55501528) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[3-(morpholine-4-carbonyl)piperidin-1-yl]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[3-(morpholine-4-carbonyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 55501528 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N-(2-ethylphenyl)-2-[3-(morpholine-4-carbonyl)piperidin-1-yl]acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1CCCC(C(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C20H29N3O3/c1-2-16-6-3-4-8-18(16)21-19(24)15-22-9-5-7-17(14-22)20(25)23-10-12-26-13-11-23/h3-4,6,8,17H,2,5,7,9-15H2,1H3,(H,21,24) |
| InChIKey | WBAPCVNMJRCFGJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |