C27H36N4O2 — CID 55987825
2-[4-(1-benzylpiperidine-3-carbonyl)piperazin-1-yl]-N-(2-ethylphenyl)acetamide (PubChem CID 55987825) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 2-[4-(1-benzylpiperidine-3-carbonyl)piperazin-1-yl]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[4-(1-benzylpiperidine-3-carbonyl)piperazin-1-yl]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 55987825 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 2-[4-(1-benzylpiperidine-3-carbonyl)piperazin-1-yl]-N-(2-ethylphenyl)acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1CCN(C(=O)C2CCCN(Cc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C27H36N4O2/c1-2-23-11-6-7-13-25(23)28-26(32)21-29-15-17-31(18-16-29)27(33)24-12-8-14-30(20-24)19-22-9-4-3-5-10-22/h3-7,9-11,13,24H,2,8,12,14-21H2,1H3,(H,28,32) |
| InChIKey | CYISCROFSOMUOK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |