C19H18FN3O3 — CID 112798327
N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-4-hydroxy-1-phenylpyrazole-3-carboxamide (PubChem CID 112798327) has the molecular formula C19H18FN3O3 and a molecular weight of 355.37 g/mol. Its IUPAC name is N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-4-hydroxy-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-4-hydroxy-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 112798327 |
| Molecular Formula | C19H18FN3O3 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-4-hydroxy-1-phenylpyrazole-3-carboxamide |
| SMILES | COc1ccc(C(C)NC(=O)c2nn(-c3ccccc3)cc2O)cc1F |
| InChI | InChI=1S/C19H18FN3O3/c1-12(13-8-9-17(26-2)15(20)10-13)21-19(25)18-16(24)11-23(22-18)14-6-4-3-5-7-14/h3-12,24H,1-2H3,(H,21,25) |
| InChIKey | QFEBMVRQSRSQJT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |