C18H24ClN3O3S2 — CID 112798578
N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-[ethyl(thiophen-2-ylmethyl)amino]propanamide (PubChem CID 112798578) has the molecular formula C18H24ClN3O3S2 and a molecular weight of 430.00 g/mol. Its IUPAC name is N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-[ethyl(thiophen-2-ylmethyl)amino]propanamide.
| Compound Name | N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-[ethyl(thiophen-2-ylmethyl)amino]propanamide |
|---|---|
| PubChem CID | 112798578 |
| Molecular Formula | C18H24ClN3O3S2 |
| Molecular Weight | 430.00 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-[ethyl(thiophen-2-ylmethyl)amino]propanamide |
| SMILES | CCN(Cc1cccs1)C(C)C(=O)Nc1ccc(Cl)c(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C18H24ClN3O3S2/c1-5-22(12-15-7-6-10-26-15)13(2)18(23)20-14-8-9-16(19)17(11-14)27(24,25)21(3)4/h6-11,13H,5,12H2,1-4H3,(H,20,23) |
| InChIKey | IOGMFHWTWHXFRO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.00 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |