C19H24ClN3O3S — CID 18093868
2-[benzyl(methyl)amino]-N-[4-chloro-3-(dimethylsulfamoyl)phenyl]propanamide (PubChem CID 18093868) has the molecular formula C19H24ClN3O3S and a molecular weight of 409.94 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]-N-[4-chloro-3-(dimethylsulfamoyl)phenyl]propanamide.
| Compound Name | 2-[benzyl(methyl)amino]-N-[4-chloro-3-(dimethylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 18093868 |
| Molecular Formula | C19H24ClN3O3S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 2-[benzyl(methyl)amino]-N-[4-chloro-3-(dimethylsulfamoyl)phenyl]propanamide |
| SMILES | CC(C(=O)Nc1ccc(Cl)c(S(=O)(=O)N(C)C)c1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C19H24ClN3O3S/c1-14(23(4)13-15-8-6-5-7-9-15)19(24)21-16-10-11-17(20)18(12-16)27(25,26)22(2)3/h5-12,14H,13H2,1-4H3,(H,21,24) |
| InChIKey | ZFIBPJMMMXQLJO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |