C22H22ClN3O3 — CID 112798635
1-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide (PubChem CID 112798635) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is 1-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 112798635 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 1-[[5-(3-chlorophenyl)-1,3-oxazol-2-yl]methyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1O)C1CCN(Cc2ncc(-c3cccc(Cl)c3)o2)CC1 |
| InChI | InChI=1S/C22H22ClN3O3/c23-17-5-3-4-16(12-17)20-13-24-21(29-20)14-26-10-8-15(9-11-26)22(28)25-18-6-1-2-7-19(18)27/h1-7,12-13,15,27H,8-11,14H2,(H,25,28) |
| InChIKey | XECGYBOANQWFQJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|