C21H26BrN3O2 — CID 112799144
2-(4-bromo-3-methylanilino)-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylpropanamide (PubChem CID 112799144) has the molecular formula C21H26BrN3O2 and a molecular weight of 432.36 g/mol. Its IUPAC name is 2-(4-bromo-3-methylanilino)-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylpropanamide.
| Compound Name | 2-(4-bromo-3-methylanilino)-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 112799144 |
| Molecular Formula | C21H26BrN3O2 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 2-(4-bromo-3-methylanilino)-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylpropanamide |
| SMILES | CCc1ccccc1NC(=O)CN(C)C(=O)C(C)Nc1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C21H26BrN3O2/c1-5-16-8-6-7-9-19(16)24-20(26)13-25(4)21(27)15(3)23-17-10-11-18(22)14(2)12-17/h6-12,15,23H,5,13H2,1-4H3,(H,24,26) |
| InChIKey | UABGLJHJZRQWKC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |