C18H29N3O2S — CID 71856374
2-[2-(dimethylamino)ethylsulfanyl]-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylpropanamide (PubChem CID 71856374) has the molecular formula C18H29N3O2S and a molecular weight of 351.52 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethylsulfanyl]-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylpropanamide.
| Compound Name | 2-[2-(dimethylamino)ethylsulfanyl]-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 71856374 |
| Molecular Formula | C18H29N3O2S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 2-[2-(dimethylamino)ethylsulfanyl]-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylpropanamide |
| SMILES | CCc1ccccc1NC(=O)CN(C)C(=O)C(C)SCCN(C)C |
| InChI | InChI=1S/C18H29N3O2S/c1-6-15-9-7-8-10-16(15)19-17(22)13-21(5)18(23)14(2)24-12-11-20(3)4/h7-10,14H,6,11-13H2,1-5H3,(H,19,22) |
| InChIKey | DDHBRATUCFZOPA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |