C22H29N5O3 — CID 112800026
N-[2-(dimethylamino)-2-phenylethyl]-2-[4-(2-nitrophenyl)piperazin-1-yl]acetamide (PubChem CID 112800026) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-phenylethyl]-2-[4-(2-nitrophenyl)piperazin-1-yl]acetamide.
| Compound Name | N-[2-(dimethylamino)-2-phenylethyl]-2-[4-(2-nitrophenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 112800026 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | N-[2-(dimethylamino)-2-phenylethyl]-2-[4-(2-nitrophenyl)piperazin-1-yl]acetamide |
| SMILES | CN(C)C(CNC(=O)CN1CCN(c2ccccc2[N+](=O)[O-])CC1)c1ccccc1 |
| InChI | InChI=1S/C22H29N5O3/c1-24(2)21(18-8-4-3-5-9-18)16-23-22(28)17-25-12-14-26(15-13-25)19-10-6-7-11-20(19)27(29)30/h3-11,21H,12-17H2,1-2H3,(H,23,28) |
| InChIKey | LQHBKFALOMOQLX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|