C22H30N4O3S — CID 112799962
2-[4-(benzenesulfonyl)piperazin-1-yl]-N-[2-(dimethylamino)-2-phenylethyl]acetamide (PubChem CID 112799962) has the molecular formula C22H30N4O3S and a molecular weight of 430.57 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-[2-(dimethylamino)-2-phenylethyl]acetamide.
| Compound Name | 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-[2-(dimethylamino)-2-phenylethyl]acetamide |
|---|---|
| PubChem CID | 112799962 |
| Molecular Formula | C22H30N4O3S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 2-[4-(benzenesulfonyl)piperazin-1-yl]-N-[2-(dimethylamino)-2-phenylethyl]acetamide |
| SMILES | CN(C)C(CNC(=O)CN1CCN(S(=O)(=O)c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H30N4O3S/c1-24(2)21(19-9-5-3-6-10-19)17-23-22(27)18-25-13-15-26(16-14-25)30(28,29)20-11-7-4-8-12-20/h3-12,21H,13-18H2,1-2H3,(H,23,27) |
| InChIKey | WBIUWSHNXQNSCJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |